C18H21N5O7S — CID 135213734
[7-(dimethylcarbamoyl)-5-methyl-9-oxo-3-(phenoxymethyl)-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate (PubChem CID 135213734) has the molecular formula C18H21N5O7S and a molecular weight of 451.46 g/mol. Its IUPAC name is [7-(dimethylcarbamoyl)-5-methyl-9-oxo-3-(phenoxymethyl)-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate.
| Compound Name | [7-(dimethylcarbamoyl)-5-methyl-9-oxo-3-(phenoxymethyl)-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 135213734 |
| Molecular Formula | C18H21N5O7S |
| Molecular Weight | 451.46 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | [7-(dimethylcarbamoyl)-5-methyl-9-oxo-3-(phenoxymethyl)-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-yl] hydrogen sulfate |
| SMILES | CN(C)C(=O)C1c2c(c(COc3ccccc3)nn2C)C2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C18H21N5O7S/c1-20(2)17(24)16-15-14(13-9-22(16)18(25)23(13)30-31(26,27)28)12(19-21(15)3)10-29-11-7-5-4-6-8-11/h4-8,13,16H,9-10H2,1-3H3,(H,26,27,28) |
| InChIKey | UGSPVJDPXGQGFX-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 134.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.46 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|