C19H21N5O9S — CID 135213836
4-[[7-(dimethylcarbamoyl)-5-methyl-9-oxo-10-sulfooxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-3-yl]methoxy]benzoic acid (PubChem CID 135213836) has the molecular formula C19H21N5O9S and a molecular weight of 495.47 g/mol. Its IUPAC name is 4-[[7-(dimethylcarbamoyl)-5-methyl-9-oxo-10-sulfooxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-3-yl]methoxy]benzoic acid.
| Compound Name | 4-[[7-(dimethylcarbamoyl)-5-methyl-9-oxo-10-sulfooxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-3-yl]methoxy]benzoic acid |
|---|---|
| PubChem CID | 135213836 |
| Molecular Formula | C19H21N5O9S |
| Molecular Weight | 495.47 g/mol |
| Exact Mass | 495.11 |
| IUPAC Name | 4-[[7-(dimethylcarbamoyl)-5-methyl-9-oxo-10-sulfooxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-3-yl]methoxy]benzoic acid |
| SMILES | CN(C)C(=O)C1c2c(c(COc3ccc(C(=O)O)cc3)nn2C)C2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C19H21N5O9S/c1-21(2)17(25)16-15-14(13-8-23(16)19(28)24(13)33-34(29,30)31)12(20-22(15)3)9-32-11-6-4-10(5-7-11)18(26)27/h4-7,13,16H,8-9H2,1-3H3,(H,26,27)(H,29,30,31) |
| InChIKey | VIKJMZDEGZWEIS-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 171.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.47 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|