C18H20N6O9S — CID 135213846
5-[[7-(dimethylcarbamoyl)-5-methyl-9-oxo-10-sulfooxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-3-yl]methoxy]pyridine-2-carboxylic acid (PubChem CID 135213846) has the molecular formula C18H20N6O9S and a molecular weight of 496.46 g/mol. Its IUPAC name is 5-[[7-(dimethylcarbamoyl)-5-methyl-9-oxo-10-sulfooxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-3-yl]methoxy]pyridine-2-carboxylic acid.
| Compound Name | 5-[[7-(dimethylcarbamoyl)-5-methyl-9-oxo-10-sulfooxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-3-yl]methoxy]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 135213846 |
| Molecular Formula | C18H20N6O9S |
| Molecular Weight | 496.46 g/mol |
| Exact Mass | 496.10 |
| IUPAC Name | 5-[[7-(dimethylcarbamoyl)-5-methyl-9-oxo-10-sulfooxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-3-yl]methoxy]pyridine-2-carboxylic acid |
| SMILES | CN(C)C(=O)C1c2c(c(COc3ccc(C(=O)O)nc3)nn2C)C2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C18H20N6O9S/c1-21(2)16(25)15-14-13(12-7-23(15)18(28)24(12)33-34(29,30)31)11(20-22(14)3)8-32-9-4-5-10(17(26)27)19-6-9/h4-6,12,15H,7-8H2,1-3H3,(H,26,27)(H,29,30,31) |
| InChIKey | VNYIRMCNQXDDDY-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 184.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.46 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|