C26H17F2N3O5 — CID 135214049
2-(2,2-difluoro-1,3-benzodioxol-5-yl)-3-(6-formyl-3,4-dihydro-2H-quinolin-1-yl)quinoxaline-6-carboxylic acid (PubChem CID 135214049) has the molecular formula C26H17F2N3O5 and a molecular weight of 489.43 g/mol. Its IUPAC name is 2-(2,2-difluoro-1,3-benzodioxol-5-yl)-3-(6-formyl-3,4-dihydro-2H-quinolin-1-yl)quinoxaline-6-carboxylic acid.
| Compound Name | 2-(2,2-difluoro-1,3-benzodioxol-5-yl)-3-(6-formyl-3,4-dihydro-2H-quinolin-1-yl)quinoxaline-6-carboxylic acid |
|---|---|
| PubChem CID | 135214049 |
| Molecular Formula | C26H17F2N3O5 |
| Molecular Weight | 489.43 g/mol |
| Exact Mass | 489.11 |
| IUPAC Name | 2-(2,2-difluoro-1,3-benzodioxol-5-yl)-3-(6-formyl-3,4-dihydro-2H-quinolin-1-yl)quinoxaline-6-carboxylic acid |
| SMILES | O=Cc1ccc2c(c1)CCCN2c1nc2cc(C(=O)O)ccc2nc1-c1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C26H17F2N3O5/c27-26(28)35-21-8-5-16(12-22(21)36-26)23-24(30-19-11-17(25(33)34)4-6-18(19)29-23)31-9-1-2-15-10-14(13-32)3-7-20(15)31/h3-8,10-13H,1-2,9H2,(H,33,34) |
| InChIKey | NWMJVSIAZBZEGO-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 101.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.43 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|