About 2-(4,5-dimethoxy-2-methylcyclohexa-2,4-dien-1-yl)ethanamine
2-(4,5-dimethoxy-2-methylcyclohexa-2,4-dien-1-yl)ethanamine (PubChem CID 135214249) has the molecular formula C11H19NO2
and a molecular weight of 197.28 g/mol. Its IUPAC name is 2-(4,5-dimethoxy-2-methylcyclohexa-2,4-dien-1-yl)ethanamine.
Molecular Properties
| Compound Name | 2-(4,5-dimethoxy-2-methylcyclohexa-2,4-dien-1-yl)ethanamine |
| PubChem CID | 135214249 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | 2-(4,5-dimethoxy-2-methylcyclohexa-2,4-dien-1-yl)ethanamine |
| SMILES | COC1=C(OC)CC(CCN)C(C)=C1 |
| InChI | InChI=1S/C11H19NO2/c1-8-6-10(13-2)11(14-3)7-9(8)4-5-12/h6,9H,4-5,7,12H2,1-3H3 |
| InChIKey | BNSQFZLVJNCHBM-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4,5-dimethoxy-2-methylcyclohexa-2,4-dien-1-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,5-dimethoxy-2-methylcyclohexa-2,4-dien-1-yl)ethanamine?
The IUPAC name of 2-(4,5-dimethoxy-2-methylcyclohexa-2,4-dien-1-yl)ethanamine (CID 135214249) is 2-(4,5-dimethoxy-2-methylcyclohexa-2,4-dien-1-yl)ethanamine.
What is the SMILES notation for 2-(4,5-dimethoxy-2-methylcyclohexa-2,4-dien-1-yl)ethanamine?
The canonical SMILES for 2-(4,5-dimethoxy-2-methylcyclohexa-2,4-dien-1-yl)ethanamine is COC1=C(OC)CC(CCN)C(C)=C1.
What is the InChIKey of 2-(4,5-dimethoxy-2-methylcyclohexa-2,4-dien-1-yl)ethanamine?
The InChIKey is BNSQFZLVJNCHBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO2/c1-8-6-10(13-2)11(14-3)7-9(8)4-5-12/h6,9H,4-5,7,12H2,1-3H3.
What are the key properties of 2-(4,5-dimethoxy-2-methylcyclohexa-2,4-dien-1-yl)ethanamine?
2-(4,5-dimethoxy-2-methylcyclohexa-2,4-dien-1-yl)ethanamine has a molecular weight of 197.28 g/mol, XLogP of 1.81, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5-dimethoxy-2-methylcyclohexa-2,4-dien-1-yl)ethanamine is sourced from PubChem (CID 135214249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).