C13H11N3OS — CID 135214525
3-amino-5-phenyl-1,3-dihydrothieno[3,2-e][1,4]diazepin-2-one (PubChem CID 135214525) has the molecular formula C13H11N3OS and a molecular weight of 257.32 g/mol. Its IUPAC name is 3-amino-5-phenyl-1,3-dihydrothieno[3,2-e][1,4]diazepin-2-one.
| Compound Name | 3-amino-5-phenyl-1,3-dihydrothieno[3,2-e][1,4]diazepin-2-one |
|---|---|
| PubChem CID | 135214525 |
| Molecular Formula | C13H11N3OS |
| Molecular Weight | 257.32 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | 3-amino-5-phenyl-1,3-dihydrothieno[3,2-e][1,4]diazepin-2-one |
| SMILES | NC1N=C(c2ccccc2)c2sccc2NC1=O |
| InChI | InChI=1S/C13H11N3OS/c14-12-13(17)15-9-6-7-18-11(9)10(16-12)8-4-2-1-3-5-8/h1-7,12H,14H2,(H,15,17) |
| InChIKey | KURAKJVJGUUHIE-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.32 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |