C16H20N4 — CID 135215438
1-N,2-N,5-N,6-N,3,7-hexamethylnaphthalene-1,2,5,6-tetraimine (PubChem CID 135215438) has the molecular formula C16H20N4 and a molecular weight of 268.36 g/mol. Its IUPAC name is 1-N,2-N,5-N,6-N,3,7-hexamethylnaphthalene-1,2,5,6-tetraimine.
| Compound Name | 1-N,2-N,5-N,6-N,3,7-hexamethylnaphthalene-1,2,5,6-tetraimine |
|---|---|
| PubChem CID | 135215438 |
| Molecular Formula | C16H20N4 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 1-N,2-N,5-N,6-N,3,7-hexamethylnaphthalene-1,2,5,6-tetraimine |
| SMILES | C/N=c1/c2cc(C)c(=N\C)/c(=N\C)c=2cc(C)/c1=N\C |
| InChI | InChI=1S/C16H20N4/c1-9-7-11-12(15(19-5)13(9)17-3)8-10(2)14(18-4)16(11)20-6/h7-8H,1-6H3/b17-13+,18-14+,19-15-,20-16- |
| InChIKey | NYSWYLNIIHBRPR-QUIZWGRCSA-N |
| XLogP | 0.03 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |