C31H25F3N4O3 — CID 135215902
5-[2-[(1S)-2-(3,5-difluorophenyl)-1-[[1-hydroxy-2-(2-oxo-1H-quinolin-4-yl)ethyl]amino]ethyl]-3-pyridinyl]-2-fluorobenzamide (PubChem CID 135215902) has the molecular formula C31H25F3N4O3 and a molecular weight of 558.56 g/mol. Its IUPAC name is 5-[2-[(1S)-2-(3,5-difluorophenyl)-1-[[1-hydroxy-2-(2-oxo-1H-quinolin-4-yl)ethyl]amino]ethyl]-3-pyridinyl]-2-fluorobenzamide.
| Compound Name | 5-[2-[(1S)-2-(3,5-difluorophenyl)-1-[[1-hydroxy-2-(2-oxo-1H-quinolin-4-yl)ethyl]amino]ethyl]-3-pyridinyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 135215902 |
| Molecular Formula | C31H25F3N4O3 |
| Molecular Weight | 558.56 g/mol |
| Exact Mass | 558.19 |
| IUPAC Name | 5-[2-[(1S)-2-(3,5-difluorophenyl)-1-[[1-hydroxy-2-(2-oxo-1H-quinolin-4-yl)ethyl]amino]ethyl]-3-pyridinyl]-2-fluorobenzamide |
| SMILES | NC(=O)c1cc(-c2cccnc2[C@H](Cc2cc(F)cc(F)c2)NC(O)Cc2cc(=O)[nH]c3ccccc23)ccc1F |
| InChI | InChI=1S/C31H25F3N4O3/c32-20-10-17(11-21(33)16-20)12-27(38-29(40)15-19-14-28(39)37-26-6-2-1-4-22(19)26)30-23(5-3-9-36-30)18-7-8-25(34)24(13-18)31(35)41/h1-11,13-14,16,27,29,38,40H,12,15H2,(H2,35,41)(H,37,39)/t27-,29?/m0/s1 |
| InChIKey | KLLPFPDBXPDDBZ-BVOOQYFDSA-N |
| XLogP | 4.54 |
| TPSA | 121.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.56 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|