About 3,4-bis[(Z)-prop-1-enyl]-1,2-dihydropyrrol-5-one
3,4-bis[(Z)-prop-1-enyl]-1,2-dihydropyrrol-5-one (PubChem CID 135216992) has the molecular formula C10H13NO
and a molecular weight of 163.22 g/mol. Its IUPAC name is 3,4-bis[(Z)-prop-1-enyl]-1,2-dihydropyrrol-5-one.
Molecular Properties
| Compound Name | 3,4-bis[(Z)-prop-1-enyl]-1,2-dihydropyrrol-5-one |
| PubChem CID | 135216992 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 3,4-bis[(Z)-prop-1-enyl]-1,2-dihydropyrrol-5-one |
| SMILES | C/C=C\C1=C(/C=C\C)C(=O)NC1 |
| InChI | InChI=1S/C10H13NO/c1-3-5-8-7-11-10(12)9(8)6-4-2/h3-6H,7H2,1-2H3,(H,11,12)/b5-3-,6-4- |
| InChIKey | BSNUAIOHXHSCGG-GLIMQPGKSA-N |
| XLogP | 1.57 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,4-bis[(Z)-prop-1-enyl]-1,2-dihydropyrrol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-bis[(Z)-prop-1-enyl]-1,2-dihydropyrrol-5-one?
The IUPAC name of 3,4-bis[(Z)-prop-1-enyl]-1,2-dihydropyrrol-5-one (CID 135216992) is 3,4-bis[(Z)-prop-1-enyl]-1,2-dihydropyrrol-5-one.
What is the SMILES notation for 3,4-bis[(Z)-prop-1-enyl]-1,2-dihydropyrrol-5-one?
The canonical SMILES for 3,4-bis[(Z)-prop-1-enyl]-1,2-dihydropyrrol-5-one is C/C=C\C1=C(/C=C\C)C(=O)NC1.
What is the InChIKey of 3,4-bis[(Z)-prop-1-enyl]-1,2-dihydropyrrol-5-one?
The InChIKey is BSNUAIOHXHSCGG-GLIMQPGKSA-N. The full InChI is InChI=1S/C10H13NO/c1-3-5-8-7-11-10(12)9(8)6-4-2/h3-6H,7H2,1-2H3,(H,11,12)/b5-3-,6-4-.
What are the key properties of 3,4-bis[(Z)-prop-1-enyl]-1,2-dihydropyrrol-5-one?
3,4-bis[(Z)-prop-1-enyl]-1,2-dihydropyrrol-5-one has a molecular weight of 163.22 g/mol, XLogP of 1.57, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-bis[(Z)-prop-1-enyl]-1,2-dihydropyrrol-5-one is sourced from PubChem (CID 135216992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).