C27H28F3NO2 — CID 135217050
9-[[(Z)-4-methoxypent-2-en-2-yl]oxymethyl]-9-methyl-5-(trifluoromethyl)-18-azatetracyclo[9.6.2.02,7.015,19]nonadeca-1(18),2(7),3,5,11,13,15(19),16-octaene (PubChem CID 135217050) has the molecular formula C27H28F3NO2 and a molecular weight of 455.52 g/mol. Its IUPAC name is 9-[[(Z)-4-methoxypent-2-en-2-yl]oxymethyl]-9-methyl-5-(trifluoromethyl)-18-azatetracyclo[9.6.2.02,7.015,19]nonadeca-1(18),2(7),3,5,11,13,15(19),16-octaene.
| Compound Name | 9-[[(Z)-4-methoxypent-2-en-2-yl]oxymethyl]-9-methyl-5-(trifluoromethyl)-18-azatetracyclo[9.6.2.02,7.015,19]nonadeca-1(18),2(7),3,5,11,13,15(19),16-octaene |
|---|---|
| PubChem CID | 135217050 |
| Molecular Formula | C27H28F3NO2 |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | 9-[[(Z)-4-methoxypent-2-en-2-yl]oxymethyl]-9-methyl-5-(trifluoromethyl)-18-azatetracyclo[9.6.2.02,7.015,19]nonadeca-1(18),2(7),3,5,11,13,15(19),16-octaene |
| SMILES | COC(C)/C=C(/C)OCC1(C)Cc2cc(C(F)(F)F)ccc2-c2ccc3cccc(c3n2)C1 |
| InChI | InChI=1S/C27H28F3NO2/c1-17(32-4)12-18(2)33-16-26(3)14-20-7-5-6-19-8-11-24(31-25(19)20)23-10-9-22(27(28,29)30)13-21(23)15-26/h5-13,17H,14-16H2,1-4H3/b18-12- |
| InChIKey | JGVFRAUVXPIGEY-PDGQHHTCSA-N |
| XLogP | 6.98 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|