About 2-ethyl-1-fluoro-4-(4-methylcyclohexa-2,4-dien-1-yl)oxybenzene
2-ethyl-1-fluoro-4-(4-methylcyclohexa-2,4-dien-1-yl)oxybenzene (PubChem CID 135217148) has the molecular formula C15H17FO
and a molecular weight of 232.30 g/mol. Its IUPAC name is 2-ethyl-1-fluoro-4-(4-methylcyclohexa-2,4-dien-1-yl)oxybenzene.
Molecular Properties
| Compound Name | 2-ethyl-1-fluoro-4-(4-methylcyclohexa-2,4-dien-1-yl)oxybenzene |
| PubChem CID | 135217148 |
| Molecular Formula | C15H17FO |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 2-ethyl-1-fluoro-4-(4-methylcyclohexa-2,4-dien-1-yl)oxybenzene |
| SMILES | CCc1cc(OC2C=CC(C)=CC2)ccc1F |
| InChI | InChI=1S/C15H17FO/c1-3-12-10-14(8-9-15(12)16)17-13-6-4-11(2)5-7-13/h4-6,8-10,13H,3,7H2,1-2H3 |
| InChIKey | PZUXMOLLORPKHE-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethyl-1-fluoro-4-(4-methylcyclohexa-2,4-dien-1-yl)oxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-1-fluoro-4-(4-methylcyclohexa-2,4-dien-1-yl)oxybenzene?
The IUPAC name of 2-ethyl-1-fluoro-4-(4-methylcyclohexa-2,4-dien-1-yl)oxybenzene (CID 135217148) is 2-ethyl-1-fluoro-4-(4-methylcyclohexa-2,4-dien-1-yl)oxybenzene.
What is the SMILES notation for 2-ethyl-1-fluoro-4-(4-methylcyclohexa-2,4-dien-1-yl)oxybenzene?
The canonical SMILES for 2-ethyl-1-fluoro-4-(4-methylcyclohexa-2,4-dien-1-yl)oxybenzene is CCc1cc(OC2C=CC(C)=CC2)ccc1F.
What is the InChIKey of 2-ethyl-1-fluoro-4-(4-methylcyclohexa-2,4-dien-1-yl)oxybenzene?
The InChIKey is PZUXMOLLORPKHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17FO/c1-3-12-10-14(8-9-15(12)16)17-13-6-4-11(2)5-7-13/h4-6,8-10,13H,3,7H2,1-2H3.
What are the key properties of 2-ethyl-1-fluoro-4-(4-methylcyclohexa-2,4-dien-1-yl)oxybenzene?
2-ethyl-1-fluoro-4-(4-methylcyclohexa-2,4-dien-1-yl)oxybenzene has a molecular weight of 232.30 g/mol, XLogP of 4.04, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-1-fluoro-4-(4-methylcyclohexa-2,4-dien-1-yl)oxybenzene is sourced from PubChem (CID 135217148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).