C26H35N5O3 — CID 135217295
N-[(3R)-1-[3-(3,4-dimethoxyphenyl)-2,6-dimethylimidazo[1,2-b]pyridazin-8-yl]pyrrolidin-3-yl]hexanamide (PubChem CID 135217295) has the molecular formula C26H35N5O3 and a molecular weight of 465.60 g/mol. Its IUPAC name is N-[(3R)-1-[3-(3,4-dimethoxyphenyl)-2,6-dimethylimidazo[1,2-b]pyridazin-8-yl]pyrrolidin-3-yl]hexanamide.
| Compound Name | N-[(3R)-1-[3-(3,4-dimethoxyphenyl)-2,6-dimethylimidazo[1,2-b]pyridazin-8-yl]pyrrolidin-3-yl]hexanamide |
|---|---|
| PubChem CID | 135217295 |
| Molecular Formula | C26H35N5O3 |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.27 |
| IUPAC Name | N-[(3R)-1-[3-(3,4-dimethoxyphenyl)-2,6-dimethylimidazo[1,2-b]pyridazin-8-yl]pyrrolidin-3-yl]hexanamide |
| SMILES | CCCCCC(=O)N[C@@H]1CCN(c2cc(C)nn3c(-c4ccc(OC)c(OC)c4)c(C)nc23)C1 |
| InChI | InChI=1S/C26H35N5O3/c1-6-7-8-9-24(32)28-20-12-13-30(16-20)21-14-17(2)29-31-25(18(3)27-26(21)31)19-10-11-22(33-4)23(15-19)34-5/h10-11,14-15,20H,6-9,12-13,16H2,1-5H3,(H,28,32)/t20-/m1/s1 |
| InChIKey | YKNCMLXMCWXKLK-HXUWFJFHSA-N |
| XLogP | 4.31 |
| TPSA | 80.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|