C23H23N5O — CID 135217314
[8-[1-[[6-(6-methyl-3-pyridinyl)pyrimidin-4-yl]amino]propan-2-yl]quinolin-4-yl]methanol (PubChem CID 135217314) has the molecular formula C23H23N5O and a molecular weight of 385.47 g/mol. Its IUPAC name is [8-[1-[[6-(6-methyl-3-pyridinyl)pyrimidin-4-yl]amino]propan-2-yl]quinolin-4-yl]methanol.
| Compound Name | [8-[1-[[6-(6-methyl-3-pyridinyl)pyrimidin-4-yl]amino]propan-2-yl]quinolin-4-yl]methanol |
|---|---|
| PubChem CID | 135217314 |
| Molecular Formula | C23H23N5O |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | [8-[1-[[6-(6-methyl-3-pyridinyl)pyrimidin-4-yl]amino]propan-2-yl]quinolin-4-yl]methanol |
| SMILES | Cc1ccc(-c2cc(NCC(C)c3cccc4c(CO)ccnc34)ncn2)cn1 |
| InChI | InChI=1S/C23H23N5O/c1-15(19-4-3-5-20-18(13-29)8-9-24-23(19)20)11-26-22-10-21(27-14-28-22)17-7-6-16(2)25-12-17/h3-10,12,14-15,29H,11,13H2,1-2H3,(H,26,27,28) |
| InChIKey | FEOVGIAJNWTLJE-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 83.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |