About 6-(3-methyl-5-morpholin-4-ylpyrazol-1-yl)-2,3-dihydropyrazin-5-amine
6-(3-methyl-5-morpholin-4-ylpyrazol-1-yl)-2,3-dihydropyrazin-5-amine (PubChem CID 135217566) has the molecular formula C12H18N6O
and a molecular weight of 262.32 g/mol. Its IUPAC name is 6-(3-methyl-5-morpholin-4-ylpyrazol-1-yl)-2,3-dihydropyrazin-5-amine.
Molecular Properties
| Compound Name | 6-(3-methyl-5-morpholin-4-ylpyrazol-1-yl)-2,3-dihydropyrazin-5-amine |
| PubChem CID | 135217566 |
| Molecular Formula | C12H18N6O |
| Molecular Weight | 262.32 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 6-(3-methyl-5-morpholin-4-ylpyrazol-1-yl)-2,3-dihydropyrazin-5-amine |
| SMILES | Cc1cc(N2CCOCC2)n(C2=NCCN=C2N)n1 |
| InChI | InChI=1S/C12H18N6O/c1-9-8-10(17-4-6-19-7-5-17)18(16-9)12-11(13)14-2-3-15-12/h8H,2-7H2,1H3,(H2,13,14) |
| InChIKey | VGYREMSNJJHLKI-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 81.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.32 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-(3-methyl-5-morpholin-4-ylpyrazol-1-yl)-2,3-dihydropyrazin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-methyl-5-morpholin-4-ylpyrazol-1-yl)-2,3-dihydropyrazin-5-amine?
The IUPAC name of 6-(3-methyl-5-morpholin-4-ylpyrazol-1-yl)-2,3-dihydropyrazin-5-amine (CID 135217566) is 6-(3-methyl-5-morpholin-4-ylpyrazol-1-yl)-2,3-dihydropyrazin-5-amine.
What is the SMILES notation for 6-(3-methyl-5-morpholin-4-ylpyrazol-1-yl)-2,3-dihydropyrazin-5-amine?
The canonical SMILES for 6-(3-methyl-5-morpholin-4-ylpyrazol-1-yl)-2,3-dihydropyrazin-5-amine is Cc1cc(N2CCOCC2)n(C2=NCCN=C2N)n1.
What is the InChIKey of 6-(3-methyl-5-morpholin-4-ylpyrazol-1-yl)-2,3-dihydropyrazin-5-amine?
The InChIKey is VGYREMSNJJHLKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N6O/c1-9-8-10(17-4-6-19-7-5-17)18(16-9)12-11(13)14-2-3-15-12/h8H,2-7H2,1H3,(H2,13,14).
What are the key properties of 6-(3-methyl-5-morpholin-4-ylpyrazol-1-yl)-2,3-dihydropyrazin-5-amine?
6-(3-methyl-5-morpholin-4-ylpyrazol-1-yl)-2,3-dihydropyrazin-5-amine has a molecular weight of 262.32 g/mol, XLogP of -0.35, 1 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-methyl-5-morpholin-4-ylpyrazol-1-yl)-2,3-dihydropyrazin-5-amine is sourced from PubChem (CID 135217566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).