C7H12FN — CID 135217717
3-fluoro-2,5-dimethyl-1,2,3,6-tetrahydropyridine (PubChem CID 135217717) has the molecular formula C7H12FN and a molecular weight of 129.18 g/mol. Its IUPAC name is 3-fluoro-2,5-dimethyl-1,2,3,6-tetrahydropyridine.
| Compound Name | 3-fluoro-2,5-dimethyl-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 135217717 |
| Molecular Formula | C7H12FN |
| Molecular Weight | 129.18 g/mol |
| Exact Mass | 129.10 |
| IUPAC Name | 3-fluoro-2,5-dimethyl-1,2,3,6-tetrahydropyridine |
| SMILES | CC1=CC(F)C(C)NC1 |
| InChI | InChI=1S/C7H12FN/c1-5-3-7(8)6(2)9-4-5/h3,6-7,9H,4H2,1-2H3 |
| InChIKey | KJRQHHVNHCHPEQ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.18 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|