About 1-butyl-3-fluoro-2,5-dimethyl-3,4-dihydro-2H-pyridine
1-butyl-3-fluoro-2,5-dimethyl-3,4-dihydro-2H-pyridine (PubChem CID 135217718) has the molecular formula C11H20FN
and a molecular weight of 185.29 g/mol. Its IUPAC name is 1-butyl-3-fluoro-2,5-dimethyl-3,4-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | 1-butyl-3-fluoro-2,5-dimethyl-3,4-dihydro-2H-pyridine |
| PubChem CID | 135217718 |
| Molecular Formula | C11H20FN |
| Molecular Weight | 185.29 g/mol |
| Exact Mass | 185.16 |
| IUPAC Name | 1-butyl-3-fluoro-2,5-dimethyl-3,4-dihydro-2H-pyridine |
| SMILES | CCCCN1C=C(C)CC(F)C1C |
| InChI | InChI=1S/C11H20FN/c1-4-5-6-13-8-9(2)7-11(12)10(13)3/h8,10-11H,4-7H2,1-3H3 |
| InChIKey | LQZDWXFBGZWQAN-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.29 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-butyl-3-fluoro-2,5-dimethyl-3,4-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-3-fluoro-2,5-dimethyl-3,4-dihydro-2H-pyridine?
The IUPAC name of 1-butyl-3-fluoro-2,5-dimethyl-3,4-dihydro-2H-pyridine (CID 135217718) is 1-butyl-3-fluoro-2,5-dimethyl-3,4-dihydro-2H-pyridine.
What is the SMILES notation for 1-butyl-3-fluoro-2,5-dimethyl-3,4-dihydro-2H-pyridine?
The canonical SMILES for 1-butyl-3-fluoro-2,5-dimethyl-3,4-dihydro-2H-pyridine is CCCCN1C=C(C)CC(F)C1C.
What is the InChIKey of 1-butyl-3-fluoro-2,5-dimethyl-3,4-dihydro-2H-pyridine?
The InChIKey is LQZDWXFBGZWQAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20FN/c1-4-5-6-13-8-9(2)7-11(12)10(13)3/h8,10-11H,4-7H2,1-3H3.
What are the key properties of 1-butyl-3-fluoro-2,5-dimethyl-3,4-dihydro-2H-pyridine?
1-butyl-3-fluoro-2,5-dimethyl-3,4-dihydro-2H-pyridine has a molecular weight of 185.29 g/mol, XLogP of 3.12, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-3-fluoro-2,5-dimethyl-3,4-dihydro-2H-pyridine is sourced from PubChem (CID 135217718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).