C12H16S — CID 135218319
1,2,3,4,4a,9,9a,9b-octahydrodibenzothiophene (PubChem CID 135218319) has the molecular formula C12H16S and a molecular weight of 192.33 g/mol. Its IUPAC name is 1,2,3,4,4a,9,9a,9b-octahydrodibenzothiophene.
| Compound Name | 1,2,3,4,4a,9,9a,9b-octahydrodibenzothiophene |
|---|---|
| PubChem CID | 135218319 |
| Molecular Formula | C12H16S |
| Molecular Weight | 192.33 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 1,2,3,4,4a,9,9a,9b-octahydrodibenzothiophene |
| SMILES | C1=CCC2C(=C1)SC1CCCCC12 |
| InChI | InChI=1S/C12H16S/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11/h1,3,7,9-10,12H,2,4-6,8H2 |
| InChIKey | NSVLXDPKWBGYRB-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.33 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |