C18H25NS — CID 135218342
(4S)-N-(cyclohexen-1-yl)-4,4a,5a,6,7,8,9,9a-octahydrodibenzothiophen-4-amine (PubChem CID 135218342) has the molecular formula C18H25NS and a molecular weight of 287.47 g/mol. Its IUPAC name is (4S)-N-(cyclohexen-1-yl)-4,4a,5a,6,7,8,9,9a-octahydrodibenzothiophen-4-amine.
| Compound Name | (4S)-N-(cyclohexen-1-yl)-4,4a,5a,6,7,8,9,9a-octahydrodibenzothiophen-4-amine |
|---|---|
| PubChem CID | 135218342 |
| Molecular Formula | C18H25NS |
| Molecular Weight | 287.47 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | (4S)-N-(cyclohexen-1-yl)-4,4a,5a,6,7,8,9,9a-octahydrodibenzothiophen-4-amine |
| SMILES | C1=C[C@H](NC2=CCCCC2)C2SC3CCCCC3C2=C1 |
| InChI | InChI=1S/C18H25NS/c1-2-7-13(8-3-1)19-16-11-6-10-15-14-9-4-5-12-17(14)20-18(15)16/h6-7,10-11,14,16-19H,1-5,8-9,12H2/t14?,16-,17?,18?/m0/s1 |
| InChIKey | IPIAFLSLYAIAAL-YTLHEZQNSA-N |
| XLogP | 4.57 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.47 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |