About (6-chloropyrido[2,3-b]pyrazin-3-yl)hydrazine
(6-chloropyrido[2,3-b]pyrazin-3-yl)hydrazine (PubChem CID 135218537) has the molecular formula C7H6ClN5
and a molecular weight of 195.61 g/mol. Its IUPAC name is (6-chloropyrido[2,3-b]pyrazin-3-yl)hydrazine.
Molecular Properties
| Compound Name | (6-chloropyrido[2,3-b]pyrazin-3-yl)hydrazine |
| PubChem CID | 135218537 |
| Molecular Formula | C7H6ClN5 |
| Molecular Weight | 195.61 g/mol |
| Exact Mass | 195.03 |
| IUPAC Name | (6-chloropyrido[2,3-b]pyrazin-3-yl)hydrazine |
| SMILES | NNc1cnc2ccc(Cl)nc2n1 |
| InChI | InChI=1S/C7H6ClN5/c8-5-2-1-4-7(11-5)12-6(13-9)3-10-4/h1-3H,9H2,(H,11,12,13) |
| InChIKey | RYBCNDWHCASRQY-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.61 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (6-chloropyrido[2,3-b]pyrazin-3-yl)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-chloropyrido[2,3-b]pyrazin-3-yl)hydrazine?
The IUPAC name of (6-chloropyrido[2,3-b]pyrazin-3-yl)hydrazine (CID 135218537) is (6-chloropyrido[2,3-b]pyrazin-3-yl)hydrazine.
What is the SMILES notation for (6-chloropyrido[2,3-b]pyrazin-3-yl)hydrazine?
The canonical SMILES for (6-chloropyrido[2,3-b]pyrazin-3-yl)hydrazine is NNc1cnc2ccc(Cl)nc2n1.
What is the InChIKey of (6-chloropyrido[2,3-b]pyrazin-3-yl)hydrazine?
The InChIKey is RYBCNDWHCASRQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6ClN5/c8-5-2-1-4-7(11-5)12-6(13-9)3-10-4/h1-3H,9H2,(H,11,12,13).
What are the key properties of (6-chloropyrido[2,3-b]pyrazin-3-yl)hydrazine?
(6-chloropyrido[2,3-b]pyrazin-3-yl)hydrazine has a molecular weight of 195.61 g/mol, XLogP of 0.96, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (6-chloropyrido[2,3-b]pyrazin-3-yl)hydrazine is sourced from PubChem (CID 135218537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).