About 4-[dimethyl(sulfanyl)-λ4-sulfanyl]piperazine-2,6-dione
4-[dimethyl(sulfanyl)-λ4-sulfanyl]piperazine-2,6-dione (PubChem CID 135218544) has the molecular formula C6H12N2O2S2
and a molecular weight of 208.31 g/mol. Its IUPAC name is 4-[dimethyl(sulfanyl)-λ4-sulfanyl]piperazine-2,6-dione.
Molecular Properties
| Compound Name | 4-[dimethyl(sulfanyl)-λ4-sulfanyl]piperazine-2,6-dione |
| PubChem CID | 135218544 |
| Molecular Formula | C6H12N2O2S2 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.03 |
| IUPAC Name | 4-[dimethyl(sulfanyl)-λ4-sulfanyl]piperazine-2,6-dione |
| SMILES | CS(C)(S)N1CC(=O)NC(=O)C1 |
| InChI | InChI=1S/C6H12N2O2S2/c1-12(2,11)8-3-5(9)7-6(10)4-8/h11H,3-4H2,1-2H3,(H,7,9,10) |
| InChIKey | ZEEHFIYWCAJFJK-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-[dimethyl(sulfanyl)-λ4-sulfanyl]piperazine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[dimethyl(sulfanyl)-λ4-sulfanyl]piperazine-2,6-dione?
The IUPAC name of 4-[dimethyl(sulfanyl)-λ4-sulfanyl]piperazine-2,6-dione (CID 135218544) is 4-[dimethyl(sulfanyl)-λ4-sulfanyl]piperazine-2,6-dione.
What is the SMILES notation for 4-[dimethyl(sulfanyl)-λ4-sulfanyl]piperazine-2,6-dione?
The canonical SMILES for 4-[dimethyl(sulfanyl)-λ4-sulfanyl]piperazine-2,6-dione is CS(C)(S)N1CC(=O)NC(=O)C1.
What is the InChIKey of 4-[dimethyl(sulfanyl)-λ4-sulfanyl]piperazine-2,6-dione?
The InChIKey is ZEEHFIYWCAJFJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O2S2/c1-12(2,11)8-3-5(9)7-6(10)4-8/h11H,3-4H2,1-2H3,(H,7,9,10).
What are the key properties of 4-[dimethyl(sulfanyl)-λ4-sulfanyl]piperazine-2,6-dione?
4-[dimethyl(sulfanyl)-λ4-sulfanyl]piperazine-2,6-dione has a molecular weight of 208.31 g/mol, XLogP of -0.23, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[dimethyl(sulfanyl)-λ4-sulfanyl]piperazine-2,6-dione is sourced from PubChem (CID 135218544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).