About 2-chloro-3-fluoro-N,4-diiodoaniline
2-chloro-3-fluoro-N,4-diiodoaniline (PubChem CID 135219075) has the molecular formula C6H3ClFI2N
and a molecular weight of 397.36 g/mol. Its IUPAC name is 2-chloro-3-fluoro-N,4-diiodoaniline.
Molecular Properties
| Compound Name | 2-chloro-3-fluoro-N,4-diiodoaniline |
| PubChem CID | 135219075 |
| Molecular Formula | C6H3ClFI2N |
| Molecular Weight | 397.36 g/mol |
| Exact Mass | 396.80 |
| IUPAC Name | 2-chloro-3-fluoro-N,4-diiodoaniline |
| SMILES | Fc1c(I)ccc(NI)c1Cl |
| InChI | InChI=1S/C6H3ClFI2N/c7-5-4(11-10)2-1-3(9)6(5)8/h1-2,11H |
| InChIKey | UWACTHFQRQVJFJ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.36 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-3-fluoro-N,4-diiodoaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-3-fluoro-N,4-diiodoaniline?
The IUPAC name of 2-chloro-3-fluoro-N,4-diiodoaniline (CID 135219075) is 2-chloro-3-fluoro-N,4-diiodoaniline.
What is the SMILES notation for 2-chloro-3-fluoro-N,4-diiodoaniline?
The canonical SMILES for 2-chloro-3-fluoro-N,4-diiodoaniline is Fc1c(I)ccc(NI)c1Cl.
What is the InChIKey of 2-chloro-3-fluoro-N,4-diiodoaniline?
The InChIKey is UWACTHFQRQVJFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3ClFI2N/c7-5-4(11-10)2-1-3(9)6(5)8/h1-2,11H.
What are the key properties of 2-chloro-3-fluoro-N,4-diiodoaniline?
2-chloro-3-fluoro-N,4-diiodoaniline has a molecular weight of 397.36 g/mol, XLogP of 3.85, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-3-fluoro-N,4-diiodoaniline is sourced from PubChem (CID 135219075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).