About 4-iodo-N,N-dimethyl-3-[(Z)-prop-1-enyl]-1H-pyrrol-2-amine
4-iodo-N,N-dimethyl-3-[(Z)-prop-1-enyl]-1H-pyrrol-2-amine (PubChem CID 135219807) has the molecular formula C9H13IN2
and a molecular weight of 276.12 g/mol. Its IUPAC name is 4-iodo-N,N-dimethyl-3-[(Z)-prop-1-enyl]-1H-pyrrol-2-amine.
Molecular Properties
| Compound Name | 4-iodo-N,N-dimethyl-3-[(Z)-prop-1-enyl]-1H-pyrrol-2-amine |
| PubChem CID | 135219807 |
| Molecular Formula | C9H13IN2 |
| Molecular Weight | 276.12 g/mol |
| Exact Mass | 276.01 |
| IUPAC Name | 4-iodo-N,N-dimethyl-3-[(Z)-prop-1-enyl]-1H-pyrrol-2-amine |
| SMILES | C/C=C\c1c(I)c[nH]c1N(C)C |
| InChI | InChI=1S/C9H13IN2/c1-4-5-7-8(10)6-11-9(7)12(2)3/h4-6,11H,1-3H3/b5-4- |
| InChIKey | XCGOVBYPVLQWEH-PLNGDYQASA-N |
| XLogP | 2.72 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.12 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-iodo-N,N-dimethyl-3-[(Z)-prop-1-enyl]-1H-pyrrol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-iodo-N,N-dimethyl-3-[(Z)-prop-1-enyl]-1H-pyrrol-2-amine?
The IUPAC name of 4-iodo-N,N-dimethyl-3-[(Z)-prop-1-enyl]-1H-pyrrol-2-amine (CID 135219807) is 4-iodo-N,N-dimethyl-3-[(Z)-prop-1-enyl]-1H-pyrrol-2-amine.
What is the SMILES notation for 4-iodo-N,N-dimethyl-3-[(Z)-prop-1-enyl]-1H-pyrrol-2-amine?
The canonical SMILES for 4-iodo-N,N-dimethyl-3-[(Z)-prop-1-enyl]-1H-pyrrol-2-amine is C/C=C\c1c(I)c[nH]c1N(C)C.
What is the InChIKey of 4-iodo-N,N-dimethyl-3-[(Z)-prop-1-enyl]-1H-pyrrol-2-amine?
The InChIKey is XCGOVBYPVLQWEH-PLNGDYQASA-N. The full InChI is InChI=1S/C9H13IN2/c1-4-5-7-8(10)6-11-9(7)12(2)3/h4-6,11H,1-3H3/b5-4-.
What are the key properties of 4-iodo-N,N-dimethyl-3-[(Z)-prop-1-enyl]-1H-pyrrol-2-amine?
4-iodo-N,N-dimethyl-3-[(Z)-prop-1-enyl]-1H-pyrrol-2-amine has a molecular weight of 276.12 g/mol, XLogP of 2.72, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-iodo-N,N-dimethyl-3-[(Z)-prop-1-enyl]-1H-pyrrol-2-amine is sourced from PubChem (CID 135219807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).