C10H17Cl2N — CID 135220109
(2E,4Z)-N,N-bis(2-chloroethyl)hexa-2,4-dien-3-amine (PubChem CID 135220109) has the molecular formula C10H17Cl2N and a molecular weight of 222.16 g/mol. Its IUPAC name is (2E,4Z)-N,N-bis(2-chloroethyl)hexa-2,4-dien-3-amine.
| Compound Name | (2E,4Z)-N,N-bis(2-chloroethyl)hexa-2,4-dien-3-amine |
|---|---|
| PubChem CID | 135220109 |
| Molecular Formula | C10H17Cl2N |
| Molecular Weight | 222.16 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | (2E,4Z)-N,N-bis(2-chloroethyl)hexa-2,4-dien-3-amine |
| SMILES | C/C=C\C(=C/C)N(CCCl)CCCl |
| InChI | InChI=1S/C10H17Cl2N/c1-3-5-10(4-2)13(8-6-11)9-7-12/h3-5H,6-9H2,1-2H3/b5-3-,10-4+ |
| InChIKey | IUCUXXZZTVDFOX-FJQHFOHYSA-N |
| XLogP | 3.25 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.16 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|