C17H26N6O2 — CID 135220228
(Z)-2-[N'-[4-[2-[2-(ethylamino)ethylamino]ethoxy]phenyl]carbamimidoyl]-4-iminobut-2-enamide (PubChem CID 135220228) has the molecular formula C17H26N6O2 and a molecular weight of 346.44 g/mol. Its IUPAC name is (Z)-2-[N'-[4-[2-[2-(ethylamino)ethylamino]ethoxy]phenyl]carbamimidoyl]-4-iminobut-2-enamide.
| Compound Name | (Z)-2-[N'-[4-[2-[2-(ethylamino)ethylamino]ethoxy]phenyl]carbamimidoyl]-4-iminobut-2-enamide |
|---|---|
| PubChem CID | 135220228 |
| Molecular Formula | C17H26N6O2 |
| Molecular Weight | 346.44 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | (Z)-2-[N'-[4-[2-[2-(ethylamino)ethylamino]ethoxy]phenyl]carbamimidoyl]-4-iminobut-2-enamide |
| SMILES | [H]/N=C/C=C(C(N)=O)/C(N)=N/c1ccc(OCCNCCNCC)cc1 |
| InChI | InChI=1S/C17H26N6O2/c1-2-21-9-10-22-11-12-25-14-5-3-13(4-6-14)23-16(19)15(7-8-18)17(20)24/h3-8,18,21-22H,2,9-12H2,1H3,(H2,19,23)(H2,20,24)/b15-7-,18-8+ |
| InChIKey | DPILWXABKRDLGE-HAFSTUDVSA-N |
| XLogP | 0.31 |
| TPSA | 138.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.44 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|