C13H20O7S3 — CID 135221191
(E)-1-[2,6,6-tris(methylsulfonyl)cyclohex-2-en-1-yl]but-2-en-1-one (PubChem CID 135221191) has the molecular formula C13H20O7S3 and a molecular weight of 384.50 g/mol. Its IUPAC name is (E)-1-[2,6,6-tris(methylsulfonyl)cyclohex-2-en-1-yl]but-2-en-1-one.
| Compound Name | (E)-1-[2,6,6-tris(methylsulfonyl)cyclohex-2-en-1-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 135221191 |
| Molecular Formula | C13H20O7S3 |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | (E)-1-[2,6,6-tris(methylsulfonyl)cyclohex-2-en-1-yl]but-2-en-1-one |
| SMILES | C/C=C/C(=O)C1C(S(C)(=O)=O)=CCCC1(S(C)(=O)=O)S(C)(=O)=O |
| InChI | InChI=1S/C13H20O7S3/c1-5-7-10(14)12-11(21(2,15)16)8-6-9-13(12,22(3,17)18)23(4,19)20/h5,7-8,12H,6,9H2,1-4H3/b7-5+ |
| InChIKey | HZHIWZRLONCRNQ-FNORWQNLSA-N |
| XLogP | 0.26 |
| TPSA | 119.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|