C33H30O4 — CID 135221457
3,4-diphenylbut-2-enoic acid;ethyl 2,3-diphenylprop-2-enoate (PubChem CID 135221457) has the molecular formula C33H30O4 and a molecular weight of 490.60 g/mol. Its IUPAC name is 3,4-diphenylbut-2-enoic acid;ethyl 2,3-diphenylprop-2-enoate.
| Compound Name | 3,4-diphenylbut-2-enoic acid;ethyl 2,3-diphenylprop-2-enoate |
|---|---|
| PubChem CID | 135221457 |
| Molecular Formula | C33H30O4 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | 3,4-diphenylbut-2-enoic acid;ethyl 2,3-diphenylprop-2-enoate |
| SMILES | CCOC(=O)C(=Cc1ccccc1)c1ccccc1.O=C(O)C=C(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H16O2.C16H14O2/c1-2-19-17(18)16(15-11-7-4-8-12-15)13-14-9-5-3-6-10-14;17-16(18)12-15(14-9-5-2-6-10-14)11-13-7-3-1-4-8-13/h3-13H,2H2,1H3;1-10,12H,11H2,(H,17,18) |
| InChIKey | MTQLMUQGUFIKRA-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|