About 6-[(2,4,6-trifluorophenyl)methoxy]hexan-2-one
6-[(2,4,6-trifluorophenyl)methoxy]hexan-2-one (PubChem CID 135222204) has the molecular formula C13H15F3O2
and a molecular weight of 260.25 g/mol. Its IUPAC name is 6-[(2,4,6-trifluorophenyl)methoxy]hexan-2-one.
Molecular Properties
| Compound Name | 6-[(2,4,6-trifluorophenyl)methoxy]hexan-2-one |
| PubChem CID | 135222204 |
| Molecular Formula | C13H15F3O2 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 6-[(2,4,6-trifluorophenyl)methoxy]hexan-2-one |
| SMILES | CC(=O)CCCCOCc1c(F)cc(F)cc1F |
| InChI | InChI=1S/C13H15F3O2/c1-9(17)4-2-3-5-18-8-11-12(15)6-10(14)7-13(11)16/h6-7H,2-5,8H2,1H3 |
| InChIKey | ROYNSFKIDBCTGF-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-[(2,4,6-trifluorophenyl)methoxy]hexan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(2,4,6-trifluorophenyl)methoxy]hexan-2-one?
The IUPAC name of 6-[(2,4,6-trifluorophenyl)methoxy]hexan-2-one (CID 135222204) is 6-[(2,4,6-trifluorophenyl)methoxy]hexan-2-one.
What is the SMILES notation for 6-[(2,4,6-trifluorophenyl)methoxy]hexan-2-one?
The canonical SMILES for 6-[(2,4,6-trifluorophenyl)methoxy]hexan-2-one is CC(=O)CCCCOCc1c(F)cc(F)cc1F.
What is the InChIKey of 6-[(2,4,6-trifluorophenyl)methoxy]hexan-2-one?
The InChIKey is ROYNSFKIDBCTGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15F3O2/c1-9(17)4-2-3-5-18-8-11-12(15)6-10(14)7-13(11)16/h6-7H,2-5,8H2,1H3.
What are the key properties of 6-[(2,4,6-trifluorophenyl)methoxy]hexan-2-one?
6-[(2,4,6-trifluorophenyl)methoxy]hexan-2-one has a molecular weight of 260.25 g/mol, XLogP of 3.38, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(2,4,6-trifluorophenyl)methoxy]hexan-2-one is sourced from PubChem (CID 135222204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).