C44H28N4O12S4Zn — CID 135223171
4-[10,15,20-tris(4-sulfophenyl)porphyrin-5-yl]benzenesulfonic acid;zinc (PubChem CID 135223171) has the molecular formula C44H28N4O12S4Zn and a molecular weight of 998.38 g/mol. Its IUPAC name is 4-[10,15,20-tris(4-sulfophenyl)porphyrin-5-yl]benzenesulfonic acid;zinc.
| Compound Name | 4-[10,15,20-tris(4-sulfophenyl)porphyrin-5-yl]benzenesulfonic acid;zinc |
|---|---|
| PubChem CID | 135223171 |
| Molecular Formula | C44H28N4O12S4Zn |
| Molecular Weight | 998.38 g/mol |
| Exact Mass | 995.99 |
| IUPAC Name | 4-[10,15,20-tris(4-sulfophenyl)porphyrin-5-yl]benzenesulfonic acid;zinc |
| SMILES | O=S(=O)(O)c1ccc(/C2=C3\C=CC(=N3)/C(c3ccc(S(=O)(=O)O)cc3)=C3/C=CC(=N3)/C(c3ccc(S(=O)(=O)O)cc3)=C3/C=CC(=N3)/C(c3ccc(S(=O)(=O)O)cc3)=C3/C=CC2=N3)cc1.[Zn] |
| InChI | InChI=1S/C44H28N4O12S4.Zn/c49-61(50,51)29-9-1-25(2-10-29)41-33-17-19-35(45-33)42(26-3-11-30(12-4-26)62(52,53)54)37-21-23-39(47-37)44(28-7-15-32(16-8-28)64(58,59)60)40-24-22-38(48-40)43(36-20-18-34(41)46-36)27-5-13-31(14-6-27)63(55,56)57;/h1-24H,(H,49,50,51)(H,52,53,54)(H,55,56,57)(H,58,59,60);/b41-33-,41-34-,42-35-,42-37-,43-36-,43-38-,44-39-,44-40-; |
| InChIKey | KAHPUQXASOBDFG-DAJBKUBHSA-N |
| XLogP | 6.67 |
| TPSA | 266.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 65 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 998.38 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|