C32H52O12 — CID 135223925
[4,5-dihydroxy-6-(hydroxymethyl)-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl] (1R,2S,6R,15S)-2,6,15-trimethyl-12-methylidenetricyclo[8.4.1.02,7]pentadecane-6-carboxylate (PubChem CID 135223925) has the molecular formula C32H52O12 and a molecular weight of 628.76 g/mol. Its IUPAC name is [4,5-dihydroxy-6-(hydroxymethyl)-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl] (1R,2S,6R,15S)-2,6,15-trimethyl-12-methylidenetricyclo[8.4.1.02,7]pentadecane-6-carboxylate.
| Compound Name | [4,5-dihydroxy-6-(hydroxymethyl)-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl] (1R,2S,6R,15S)-2,6,15-trimethyl-12-methylidenetricyclo[8.4.1.02,7]pentadecane-6-carboxylate |
|---|---|
| PubChem CID | 135223925 |
| Molecular Formula | C32H52O12 |
| Molecular Weight | 628.76 g/mol |
| Exact Mass | 628.35 |
| IUPAC Name | [4,5-dihydroxy-6-(hydroxymethyl)-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl] (1R,2S,6R,15S)-2,6,15-trimethyl-12-methylidenetricyclo[8.4.1.02,7]pentadecane-6-carboxylate |
| SMILES | C=C1CC[C@@H]2[C@@H](C)C(CCC3[C@](C)(C(=O)OC4OC(CO)C(O)C(O)C4OC4OC(CO)C(O)C(O)C4O)CCC[C@]32C)C1 |
| InChI | InChI=1S/C32H52O12/c1-15-6-8-18-16(2)17(12-15)7-9-21-31(18,3)10-5-11-32(21,4)30(40)44-29-27(25(38)23(36)20(14-34)42-29)43-28-26(39)24(37)22(35)19(13-33)41-28/h16-29,33-39H,1,5-14H2,2-4H3/t16-,17?,18+,19?,20?,21?,22?,23?,24?,25?,26?,27?,28?,29?,31-,32+/m0/s1 |
| InChIKey | DXIRYXQYYWIBBY-OTLHZZFWSA-N |
| XLogP | 0.37 |
| TPSA | 195.60 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.76 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|