C20H30F2N2 — CID 135224090
(3R)-N-butyl-4-[(Z)-1-(2,5-difluorophenyl)prop-1-enyl]imino-2,2-dimethylpentan-3-amine (PubChem CID 135224090) has the molecular formula C20H30F2N2 and a molecular weight of 336.47 g/mol. Its IUPAC name is (3R)-N-butyl-4-[(Z)-1-(2,5-difluorophenyl)prop-1-enyl]imino-2,2-dimethylpentan-3-amine.
| Compound Name | (3R)-N-butyl-4-[(Z)-1-(2,5-difluorophenyl)prop-1-enyl]imino-2,2-dimethylpentan-3-amine |
|---|---|
| PubChem CID | 135224090 |
| Molecular Formula | C20H30F2N2 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.24 |
| IUPAC Name | (3R)-N-butyl-4-[(Z)-1-(2,5-difluorophenyl)prop-1-enyl]imino-2,2-dimethylpentan-3-amine |
| SMILES | C/C=C(\N=C(/C)[C@H](NCCCC)C(C)(C)C)c1cc(F)ccc1F |
| InChI | InChI=1S/C20H30F2N2/c1-7-9-12-23-19(20(4,5)6)14(3)24-18(8-2)16-13-15(21)10-11-17(16)22/h8,10-11,13,19,23H,7,9,12H2,1-6H3/b18-8-,24-14+/t19-/m0/s1 |
| InChIKey | JBWIJDVODDLJCV-LFPDFLPNSA-N |
| XLogP | 5.59 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|