About (3R)-4-[(Z)-1-(2,5-difluorophenyl)prop-1-enyl]imino-2,2-dimethylpentan-3-amine
(3R)-4-[(Z)-1-(2,5-difluorophenyl)prop-1-enyl]imino-2,2-dimethylpentan-3-amine (PubChem CID 135224098) has the molecular formula C16H22F2N2
and a molecular weight of 280.36 g/mol. Its IUPAC name is (3R)-4-[(Z)-1-(2,5-difluorophenyl)prop-1-enyl]imino-2,2-dimethylpentan-3-amine.
Molecular Properties
| Compound Name | (3R)-4-[(Z)-1-(2,5-difluorophenyl)prop-1-enyl]imino-2,2-dimethylpentan-3-amine |
| PubChem CID | 135224098 |
| Molecular Formula | C16H22F2N2 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | (3R)-4-[(Z)-1-(2,5-difluorophenyl)prop-1-enyl]imino-2,2-dimethylpentan-3-amine |
| SMILES | C/C=C(\N=C(/C)[C@H](N)C(C)(C)C)c1cc(F)ccc1F |
| InChI | InChI=1S/C16H22F2N2/c1-6-14(12-9-11(17)7-8-13(12)18)20-10(2)15(19)16(3,4)5/h6-9,15H,19H2,1-5H3/b14-6-,20-10+/t15-/m0/s1 |
| InChIKey | NTCBXLHYRCYIOP-RJANJZLSSA-N |
| XLogP | 4.16 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (3R)-4-[(Z)-1-(2,5-difluorophenyl)prop-1-enyl]imino-2,2-dimethylpentan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-4-[(Z)-1-(2,5-difluorophenyl)prop-1-enyl]imino-2,2-dimethylpentan-3-amine?
The IUPAC name of (3R)-4-[(Z)-1-(2,5-difluorophenyl)prop-1-enyl]imino-2,2-dimethylpentan-3-amine (CID 135224098) is (3R)-4-[(Z)-1-(2,5-difluorophenyl)prop-1-enyl]imino-2,2-dimethylpentan-3-amine.
What is the SMILES notation for (3R)-4-[(Z)-1-(2,5-difluorophenyl)prop-1-enyl]imino-2,2-dimethylpentan-3-amine?
The canonical SMILES for (3R)-4-[(Z)-1-(2,5-difluorophenyl)prop-1-enyl]imino-2,2-dimethylpentan-3-amine is C/C=C(\N=C(/C)[C@H](N)C(C)(C)C)c1cc(F)ccc1F.
What is the InChIKey of (3R)-4-[(Z)-1-(2,5-difluorophenyl)prop-1-enyl]imino-2,2-dimethylpentan-3-amine?
The InChIKey is NTCBXLHYRCYIOP-RJANJZLSSA-N. The full InChI is InChI=1S/C16H22F2N2/c1-6-14(12-9-11(17)7-8-13(12)18)20-10(2)15(19)16(3,4)5/h6-9,15H,19H2,1-5H3/b14-6-,20-10+/t15-/m0/s1.
What are the key properties of (3R)-4-[(Z)-1-(2,5-difluorophenyl)prop-1-enyl]imino-2,2-dimethylpentan-3-amine?
(3R)-4-[(Z)-1-(2,5-difluorophenyl)prop-1-enyl]imino-2,2-dimethylpentan-3-amine has a molecular weight of 280.36 g/mol, XLogP of 4.16, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-4-[(Z)-1-(2,5-difluorophenyl)prop-1-enyl]imino-2,2-dimethylpentan-3-amine is sourced from PubChem (CID 135224098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).