C7H11FN2 — CID 135224619
2-fluoro-5-propan-2-yl-1,2-dihydropyrimidine (PubChem CID 135224619) has the molecular formula C7H11FN2 and a molecular weight of 142.18 g/mol. Its IUPAC name is 2-fluoro-5-propan-2-yl-1,2-dihydropyrimidine.
| Compound Name | 2-fluoro-5-propan-2-yl-1,2-dihydropyrimidine |
|---|---|
| PubChem CID | 135224619 |
| Molecular Formula | C7H11FN2 |
| Molecular Weight | 142.18 g/mol |
| Exact Mass | 142.09 |
| IUPAC Name | 2-fluoro-5-propan-2-yl-1,2-dihydropyrimidine |
| SMILES | CC(C)C1=CNC(F)N=C1 |
| InChI | InChI=1S/C7H11FN2/c1-5(2)6-3-9-7(8)10-4-6/h3-5,7,9H,1-2H3 |
| InChIKey | LSIKOQHZPVJSSG-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.18 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|