C9H19NO2 — CID 135225035
(2R,3S,4R,5S)-2-ethyl-4-(ethylamino)-5-methyloxolan-3-ol (PubChem CID 135225035) has the molecular formula C9H19NO2 and a molecular weight of 173.26 g/mol. Its IUPAC name is (2R,3S,4R,5S)-2-ethyl-4-(ethylamino)-5-methyloxolan-3-ol.
| Compound Name | (2R,3S,4R,5S)-2-ethyl-4-(ethylamino)-5-methyloxolan-3-ol |
|---|---|
| PubChem CID | 135225035 |
| Molecular Formula | C9H19NO2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.14 |
| IUPAC Name | (2R,3S,4R,5S)-2-ethyl-4-(ethylamino)-5-methyloxolan-3-ol |
| SMILES | CCN[C@@H]1[C@H](O)[C@@H](CC)O[C@H]1C |
| InChI | InChI=1S/C9H19NO2/c1-4-7-9(11)8(10-5-2)6(3)12-7/h6-11H,4-5H2,1-3H3/t6-,7+,8-,9+/m0/s1 |
| InChIKey | VXASXRANXNWYSL-UYXSQOIJSA-N |
| XLogP | 0.52 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |