About 1-[(4Z,6E)-4-ethenyl-7-hexoxyocta-4,6-dienyl]pyrrolidine
1-[(4Z,6E)-4-ethenyl-7-hexoxyocta-4,6-dienyl]pyrrolidine (PubChem CID 135225350) has the molecular formula C20H35NO
and a molecular weight of 305.51 g/mol. Its IUPAC name is 1-[(4Z,6E)-4-ethenyl-7-hexoxyocta-4,6-dienyl]pyrrolidine.
Molecular Properties
| Compound Name | 1-[(4Z,6E)-4-ethenyl-7-hexoxyocta-4,6-dienyl]pyrrolidine |
| PubChem CID | 135225350 |
| Molecular Formula | C20H35NO |
| Molecular Weight | 305.51 g/mol |
| Exact Mass | 305.27 |
| IUPAC Name | 1-[(4Z,6E)-4-ethenyl-7-hexoxyocta-4,6-dienyl]pyrrolidine |
| SMILES | C=C/C(=C\C=C(/C)OCCCCCC)CCCN1CCCC1 |
| InChI | InChI=1S/C20H35NO/c1-4-6-7-10-18-22-19(3)13-14-20(5-2)12-11-17-21-15-8-9-16-21/h5,13-14H,2,4,6-12,15-18H2,1,3H3/b19-13+,20-14+ |
| InChIKey | RNESRJOUKJFVFC-IWGRKNQJSA-N |
| XLogP | 5.48 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 305.51 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(4Z,6E)-4-ethenyl-7-hexoxyocta-4,6-dienyl]pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4Z,6E)-4-ethenyl-7-hexoxyocta-4,6-dienyl]pyrrolidine?
The IUPAC name of 1-[(4Z,6E)-4-ethenyl-7-hexoxyocta-4,6-dienyl]pyrrolidine (CID 135225350) is 1-[(4Z,6E)-4-ethenyl-7-hexoxyocta-4,6-dienyl]pyrrolidine.
What is the SMILES notation for 1-[(4Z,6E)-4-ethenyl-7-hexoxyocta-4,6-dienyl]pyrrolidine?
The canonical SMILES for 1-[(4Z,6E)-4-ethenyl-7-hexoxyocta-4,6-dienyl]pyrrolidine is C=C/C(=C\C=C(/C)OCCCCCC)CCCN1CCCC1.
What is the InChIKey of 1-[(4Z,6E)-4-ethenyl-7-hexoxyocta-4,6-dienyl]pyrrolidine?
The InChIKey is RNESRJOUKJFVFC-IWGRKNQJSA-N. The full InChI is InChI=1S/C20H35NO/c1-4-6-7-10-18-22-19(3)13-14-20(5-2)12-11-17-21-15-8-9-16-21/h5,13-14H,2,4,6-12,15-18H2,1,3H3/b19-13+,20-14+.
What are the key properties of 1-[(4Z,6E)-4-ethenyl-7-hexoxyocta-4,6-dienyl]pyrrolidine?
1-[(4Z,6E)-4-ethenyl-7-hexoxyocta-4,6-dienyl]pyrrolidine has a molecular weight of 305.51 g/mol, XLogP of 5.48, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4Z,6E)-4-ethenyl-7-hexoxyocta-4,6-dienyl]pyrrolidine is sourced from PubChem (CID 135225350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).