C14H20O3 — CID 135225406
(7E,9E)-10-methoxy-9-methyl-6-oxododeca-7,9,11-trienal (PubChem CID 135225406) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is (7E,9E)-10-methoxy-9-methyl-6-oxododeca-7,9,11-trienal.
| Compound Name | (7E,9E)-10-methoxy-9-methyl-6-oxododeca-7,9,11-trienal |
|---|---|
| PubChem CID | 135225406 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | (7E,9E)-10-methoxy-9-methyl-6-oxododeca-7,9,11-trienal |
| SMILES | C=C/C(OC)=C(C)\C=C\C(=O)CCCCC=O |
| InChI | InChI=1S/C14H20O3/c1-4-14(17-3)12(2)9-10-13(16)8-6-5-7-11-15/h4,9-11H,1,5-8H2,2-3H3/b10-9+,14-12+ |
| InChIKey | AYAUANRGPHLIHW-MSEVIDPPSA-N |
| XLogP | 2.98 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|