C10H15NO — CID 135225419
(2E,4Z)-N-ethenyl-6-methoxyhepta-2,4,6-trien-1-amine (PubChem CID 135225419) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is (2E,4Z)-N-ethenyl-6-methoxyhepta-2,4,6-trien-1-amine.
| Compound Name | (2E,4Z)-N-ethenyl-6-methoxyhepta-2,4,6-trien-1-amine |
|---|---|
| PubChem CID | 135225419 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | (2E,4Z)-N-ethenyl-6-methoxyhepta-2,4,6-trien-1-amine |
| SMILES | C=CNC/C=C/C=C\C(=C)OC |
| InChI | InChI=1S/C10H15NO/c1-4-11-9-7-5-6-8-10(2)12-3/h4-8,11H,1-2,9H2,3H3/b7-5+,8-6- |
| InChIKey | RZWVVEUVEJIBJK-YMBWGVAGSA-N |
| XLogP | 1.99 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|