About (1Z,3Z)-2-methyl-8-pyrrolidin-1-ylocta-1,3-diene-1-thiol
(1Z,3Z)-2-methyl-8-pyrrolidin-1-ylocta-1,3-diene-1-thiol (PubChem CID 135225424) has the molecular formula C13H23NS
and a molecular weight of 225.40 g/mol. Its IUPAC name is (1Z,3Z)-2-methyl-8-pyrrolidin-1-ylocta-1,3-diene-1-thiol.
Molecular Properties
| Compound Name | (1Z,3Z)-2-methyl-8-pyrrolidin-1-ylocta-1,3-diene-1-thiol |
| PubChem CID | 135225424 |
| Molecular Formula | C13H23NS |
| Molecular Weight | 225.40 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | (1Z,3Z)-2-methyl-8-pyrrolidin-1-ylocta-1,3-diene-1-thiol |
| SMILES | CC(/C=C\CCCCN1CCCC1)=C/S |
| InChI | InChI=1S/C13H23NS/c1-13(12-15)8-4-2-3-5-9-14-10-6-7-11-14/h4,8,12,15H,2-3,5-7,9-11H2,1H3/b8-4-,13-12- |
| InChIKey | NSXOGLBSOBEWFY-BELCGLOLSA-N |
| XLogP | 3.64 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.40 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (1Z,3Z)-2-methyl-8-pyrrolidin-1-ylocta-1,3-diene-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z,3Z)-2-methyl-8-pyrrolidin-1-ylocta-1,3-diene-1-thiol?
The IUPAC name of (1Z,3Z)-2-methyl-8-pyrrolidin-1-ylocta-1,3-diene-1-thiol (CID 135225424) is (1Z,3Z)-2-methyl-8-pyrrolidin-1-ylocta-1,3-diene-1-thiol.
What is the SMILES notation for (1Z,3Z)-2-methyl-8-pyrrolidin-1-ylocta-1,3-diene-1-thiol?
The canonical SMILES for (1Z,3Z)-2-methyl-8-pyrrolidin-1-ylocta-1,3-diene-1-thiol is CC(/C=C\CCCCN1CCCC1)=C/S.
What is the InChIKey of (1Z,3Z)-2-methyl-8-pyrrolidin-1-ylocta-1,3-diene-1-thiol?
The InChIKey is NSXOGLBSOBEWFY-BELCGLOLSA-N. The full InChI is InChI=1S/C13H23NS/c1-13(12-15)8-4-2-3-5-9-14-10-6-7-11-14/h4,8,12,15H,2-3,5-7,9-11H2,1H3/b8-4-,13-12-.
What are the key properties of (1Z,3Z)-2-methyl-8-pyrrolidin-1-ylocta-1,3-diene-1-thiol?
(1Z,3Z)-2-methyl-8-pyrrolidin-1-ylocta-1,3-diene-1-thiol has a molecular weight of 225.40 g/mol, XLogP of 3.64, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z,3Z)-2-methyl-8-pyrrolidin-1-ylocta-1,3-diene-1-thiol is sourced from PubChem (CID 135225424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).