About 1-[(E)-6,7-dimethoxy-4-methylidenenon-5-enyl]pyrrolidine
1-[(E)-6,7-dimethoxy-4-methylidenenon-5-enyl]pyrrolidine (PubChem CID 135225581) has the molecular formula C16H29NO2
and a molecular weight of 267.41 g/mol. Its IUPAC name is 1-[(E)-6,7-dimethoxy-4-methylidenenon-5-enyl]pyrrolidine.
Molecular Properties
| Compound Name | 1-[(E)-6,7-dimethoxy-4-methylidenenon-5-enyl]pyrrolidine |
| PubChem CID | 135225581 |
| Molecular Formula | C16H29NO2 |
| Molecular Weight | 267.41 g/mol |
| Exact Mass | 267.22 |
| IUPAC Name | 1-[(E)-6,7-dimethoxy-4-methylidenenon-5-enyl]pyrrolidine |
| SMILES | C=C(/C=C(/OC)C(CC)OC)CCCN1CCCC1 |
| InChI | InChI=1S/C16H29NO2/c1-5-15(18-3)16(19-4)13-14(2)9-8-12-17-10-6-7-11-17/h13,15H,2,5-12H2,1,3-4H3/b16-13+ |
| InChIKey | GOUKWPPKUIZDHF-DTQAZKPQSA-N |
| XLogP | 3.37 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.41 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(E)-6,7-dimethoxy-4-methylidenenon-5-enyl]pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-6,7-dimethoxy-4-methylidenenon-5-enyl]pyrrolidine?
The IUPAC name of 1-[(E)-6,7-dimethoxy-4-methylidenenon-5-enyl]pyrrolidine (CID 135225581) is 1-[(E)-6,7-dimethoxy-4-methylidenenon-5-enyl]pyrrolidine.
What is the SMILES notation for 1-[(E)-6,7-dimethoxy-4-methylidenenon-5-enyl]pyrrolidine?
The canonical SMILES for 1-[(E)-6,7-dimethoxy-4-methylidenenon-5-enyl]pyrrolidine is C=C(/C=C(/OC)C(CC)OC)CCCN1CCCC1.
What is the InChIKey of 1-[(E)-6,7-dimethoxy-4-methylidenenon-5-enyl]pyrrolidine?
The InChIKey is GOUKWPPKUIZDHF-DTQAZKPQSA-N. The full InChI is InChI=1S/C16H29NO2/c1-5-15(18-3)16(19-4)13-14(2)9-8-12-17-10-6-7-11-17/h13,15H,2,5-12H2,1,3-4H3/b16-13+.
What are the key properties of 1-[(E)-6,7-dimethoxy-4-methylidenenon-5-enyl]pyrrolidine?
1-[(E)-6,7-dimethoxy-4-methylidenenon-5-enyl]pyrrolidine has a molecular weight of 267.41 g/mol, XLogP of 3.37, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-6,7-dimethoxy-4-methylidenenon-5-enyl]pyrrolidine is sourced from PubChem (CID 135225581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).