About 1-[(Z,4Z)-12-fluoro-4-propylidenedodec-5-enyl]pyrrolidine
1-[(Z,4Z)-12-fluoro-4-propylidenedodec-5-enyl]pyrrolidine (PubChem CID 135225593) has the molecular formula C19H34FN
and a molecular weight of 295.49 g/mol. Its IUPAC name is 1-[(Z,4Z)-12-fluoro-4-propylidenedodec-5-enyl]pyrrolidine.
Molecular Properties
| Compound Name | 1-[(Z,4Z)-12-fluoro-4-propylidenedodec-5-enyl]pyrrolidine |
| PubChem CID | 135225593 |
| Molecular Formula | C19H34FN |
| Molecular Weight | 295.49 g/mol |
| Exact Mass | 295.27 |
| IUPAC Name | 1-[(Z,4Z)-12-fluoro-4-propylidenedodec-5-enyl]pyrrolidine |
| SMILES | CC/C=C(\C=C/CCCCCCF)CCCN1CCCC1 |
| InChI | InChI=1S/C19H34FN/c1-2-12-19(13-7-5-3-4-6-8-15-20)14-11-18-21-16-9-10-17-21/h7,12-13H,2-6,8-11,14-18H2,1H3/b13-7-,19-12+ |
| InChIKey | IVLZZKQTLIXBDP-OAFNUXESSA-N |
| XLogP | 5.68 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 295.49 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(Z,4Z)-12-fluoro-4-propylidenedodec-5-enyl]pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(Z,4Z)-12-fluoro-4-propylidenedodec-5-enyl]pyrrolidine?
The IUPAC name of 1-[(Z,4Z)-12-fluoro-4-propylidenedodec-5-enyl]pyrrolidine (CID 135225593) is 1-[(Z,4Z)-12-fluoro-4-propylidenedodec-5-enyl]pyrrolidine.
What is the SMILES notation for 1-[(Z,4Z)-12-fluoro-4-propylidenedodec-5-enyl]pyrrolidine?
The canonical SMILES for 1-[(Z,4Z)-12-fluoro-4-propylidenedodec-5-enyl]pyrrolidine is CC/C=C(\C=C/CCCCCCF)CCCN1CCCC1.
What is the InChIKey of 1-[(Z,4Z)-12-fluoro-4-propylidenedodec-5-enyl]pyrrolidine?
The InChIKey is IVLZZKQTLIXBDP-OAFNUXESSA-N. The full InChI is InChI=1S/C19H34FN/c1-2-12-19(13-7-5-3-4-6-8-15-20)14-11-18-21-16-9-10-17-21/h7,12-13H,2-6,8-11,14-18H2,1H3/b13-7-,19-12+.
What are the key properties of 1-[(Z,4Z)-12-fluoro-4-propylidenedodec-5-enyl]pyrrolidine?
1-[(Z,4Z)-12-fluoro-4-propylidenedodec-5-enyl]pyrrolidine has a molecular weight of 295.49 g/mol, XLogP of 5.68, 12 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(Z,4Z)-12-fluoro-4-propylidenedodec-5-enyl]pyrrolidine is sourced from PubChem (CID 135225593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).