C33H53FN2O2 — CID 135225668
1-[4-(aminomethyl)-6-methylcyclohexa-1,3-dien-1-yl]-10-[[(4Z,6E)-4-ethenyl-12-fluoro-7-methyldodeca-4,6-dienyl]amino]decane-1,6-dione (PubChem CID 135225668) has the molecular formula C33H53FN2O2 and a molecular weight of 528.80 g/mol. Its IUPAC name is 1-[4-(aminomethyl)-6-methylcyclohexa-1,3-dien-1-yl]-10-[[(4Z,6E)-4-ethenyl-12-fluoro-7-methyldodeca-4,6-dienyl]amino]decane-1,6-dione.
| Compound Name | 1-[4-(aminomethyl)-6-methylcyclohexa-1,3-dien-1-yl]-10-[[(4Z,6E)-4-ethenyl-12-fluoro-7-methyldodeca-4,6-dienyl]amino]decane-1,6-dione |
|---|---|
| PubChem CID | 135225668 |
| Molecular Formula | C33H53FN2O2 |
| Molecular Weight | 528.80 g/mol |
| Exact Mass | 528.41 |
| IUPAC Name | 1-[4-(aminomethyl)-6-methylcyclohexa-1,3-dien-1-yl]-10-[[(4Z,6E)-4-ethenyl-12-fluoro-7-methyldodeca-4,6-dienyl]amino]decane-1,6-dione |
| SMILES | C=C/C(=C\C=C(/C)CCCCCF)CCCNCCCCC(=O)CCCCC(=O)C1=CC=C(CN)CC1C |
| InChI | InChI=1S/C33H53FN2O2/c1-4-29(19-18-27(2)13-6-5-10-22-34)14-12-24-36-23-11-9-16-31(37)15-7-8-17-33(38)32-21-20-30(26-35)25-28(32)3/h4,18-21,28,36H,1,5-17,22-26,35H2,2-3H3/b27-18+,29-19+ |
| InChIKey | FCLWZSSOWHYGDX-IMUYLQHBSA-N |
| XLogP | 7.66 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.80 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|