C31H31F2N7O3 — CID 135226261
1-[(2S,3R,5S)-2-(3,4-difluorophenyl)-5-(2-methoxyethyl)oxolan-3-yl]-3-[4-methyl-3-(1-methylpyrazolo[3,4-b]pyridin-5-yl)-1-phenylpyrazol-5-yl]urea (PubChem CID 135226261) has the molecular formula C31H31F2N7O3 and a molecular weight of 587.63 g/mol. Its IUPAC name is 1-[(2S,3R,5S)-2-(3,4-difluorophenyl)-5-(2-methoxyethyl)oxolan-3-yl]-3-[4-methyl-3-(1-methylpyrazolo[3,4-b]pyridin-5-yl)-1-phenylpyrazol-5-yl]urea.
| Compound Name | 1-[(2S,3R,5S)-2-(3,4-difluorophenyl)-5-(2-methoxyethyl)oxolan-3-yl]-3-[4-methyl-3-(1-methylpyrazolo[3,4-b]pyridin-5-yl)-1-phenylpyrazol-5-yl]urea |
|---|---|
| PubChem CID | 135226261 |
| Molecular Formula | C31H31F2N7O3 |
| Molecular Weight | 587.63 g/mol |
| Exact Mass | 587.25 |
| IUPAC Name | 1-[(2S,3R,5S)-2-(3,4-difluorophenyl)-5-(2-methoxyethyl)oxolan-3-yl]-3-[4-methyl-3-(1-methylpyrazolo[3,4-b]pyridin-5-yl)-1-phenylpyrazol-5-yl]urea |
| SMILES | COCC[C@@H]1C[C@@H](NC(=O)Nc2c(C)c(-c3cnc4c(cnn4C)c3)nn2-c2ccccc2)[C@H](c2ccc(F)c(F)c2)O1 |
| InChI | InChI=1S/C31H31F2N7O3/c1-18-27(20-13-21-17-35-39(2)30(21)34-16-20)38-40(22-7-5-4-6-8-22)29(18)37-31(41)36-26-15-23(11-12-42-3)43-28(26)19-9-10-24(32)25(33)14-19/h4-10,13-14,16-17,23,26,28H,11-12,15H2,1-3H3,(H2,36,37,41)/t23-,26-,28+/m1/s1 |
| InChIKey | FBQIFWUMLWACSP-RJRADHEHSA-N |
| XLogP | 5.46 |
| TPSA | 108.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.63 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |