About (6S)-3,6-dimethyl-2-methylidene-6-(8-prop-1-ynyldibenzothiophen-2-yl)-1,3-diazinan-4-one
(6S)-3,6-dimethyl-2-methylidene-6-(8-prop-1-ynyldibenzothiophen-2-yl)-1,3-diazinan-4-one (PubChem CID 135226612) has the molecular formula C22H20N2OS
and a molecular weight of 360.48 g/mol. Its IUPAC name is (6S)-3,6-dimethyl-2-methylidene-6-(8-prop-1-ynyldibenzothiophen-2-yl)-1,3-diazinan-4-one.
Molecular Properties
| Compound Name | (6S)-3,6-dimethyl-2-methylidene-6-(8-prop-1-ynyldibenzothiophen-2-yl)-1,3-diazinan-4-one |
| PubChem CID | 135226612 |
| Molecular Formula | C22H20N2OS |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | (6S)-3,6-dimethyl-2-methylidene-6-(8-prop-1-ynyldibenzothiophen-2-yl)-1,3-diazinan-4-one |
| SMILES | C=C1N[C@](C)(c2ccc3sc4ccc(C#CC)cc4c3c2)CC(=O)N1C |
| InChI | InChI=1S/C22H20N2OS/c1-5-6-15-7-9-19-17(11-15)18-12-16(8-10-20(18)26-19)22(3)13-21(25)24(4)14(2)23-22/h7-12,23H,2,13H2,1,3-4H3/t22-/m0/s1 |
| InChIKey | MNOBBOYSVOUXSN-QFIPXVFZSA-N |
| XLogP | 4.56 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (6S)-3,6-dimethyl-2-methylidene-6-(8-prop-1-ynyldibenzothiophen-2-yl)-1,3-diazinan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S)-3,6-dimethyl-2-methylidene-6-(8-prop-1-ynyldibenzothiophen-2-yl)-1,3-diazinan-4-one?
The IUPAC name of (6S)-3,6-dimethyl-2-methylidene-6-(8-prop-1-ynyldibenzothiophen-2-yl)-1,3-diazinan-4-one (CID 135226612) is (6S)-3,6-dimethyl-2-methylidene-6-(8-prop-1-ynyldibenzothiophen-2-yl)-1,3-diazinan-4-one.
What is the SMILES notation for (6S)-3,6-dimethyl-2-methylidene-6-(8-prop-1-ynyldibenzothiophen-2-yl)-1,3-diazinan-4-one?
The canonical SMILES for (6S)-3,6-dimethyl-2-methylidene-6-(8-prop-1-ynyldibenzothiophen-2-yl)-1,3-diazinan-4-one is C=C1N[C@](C)(c2ccc3sc4ccc(C#CC)cc4c3c2)CC(=O)N1C.
What is the InChIKey of (6S)-3,6-dimethyl-2-methylidene-6-(8-prop-1-ynyldibenzothiophen-2-yl)-1,3-diazinan-4-one?
The InChIKey is MNOBBOYSVOUXSN-QFIPXVFZSA-N. The full InChI is InChI=1S/C22H20N2OS/c1-5-6-15-7-9-19-17(11-15)18-12-16(8-10-20(18)26-19)22(3)13-21(25)24(4)14(2)23-22/h7-12,23H,2,13H2,1,3-4H3/t22-/m0/s1.
What are the key properties of (6S)-3,6-dimethyl-2-methylidene-6-(8-prop-1-ynyldibenzothiophen-2-yl)-1,3-diazinan-4-one?
(6S)-3,6-dimethyl-2-methylidene-6-(8-prop-1-ynyldibenzothiophen-2-yl)-1,3-diazinan-4-one has a molecular weight of 360.48 g/mol, XLogP of 4.56, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6S)-3,6-dimethyl-2-methylidene-6-(8-prop-1-ynyldibenzothiophen-2-yl)-1,3-diazinan-4-one is sourced from PubChem (CID 135226612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).