C9H16N2 — CID 135226701
5-methyl-2,3,3a,4,7,7a-hexahydroindol-1-amine (PubChem CID 135226701) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is 5-methyl-2,3,3a,4,7,7a-hexahydroindol-1-amine.
| Compound Name | 5-methyl-2,3,3a,4,7,7a-hexahydroindol-1-amine |
|---|---|
| PubChem CID | 135226701 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 5-methyl-2,3,3a,4,7,7a-hexahydroindol-1-amine |
| SMILES | CC1=CCC2C(CCN2N)C1 |
| InChI | InChI=1S/C9H16N2/c1-7-2-3-9-8(6-7)4-5-11(9)10/h2,8-9H,3-6,10H2,1H3 |
| InChIKey | XSEDQIVYLNPDBO-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|