C11H19N — CID 135226733
1,6-dimethyl-3,4,4a,5,8,8a-hexahydro-2H-quinoline (PubChem CID 135226733) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is 1,6-dimethyl-3,4,4a,5,8,8a-hexahydro-2H-quinoline.
| Compound Name | 1,6-dimethyl-3,4,4a,5,8,8a-hexahydro-2H-quinoline |
|---|---|
| PubChem CID | 135226733 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | 1,6-dimethyl-3,4,4a,5,8,8a-hexahydro-2H-quinoline |
| SMILES | CC1=CCC2C(CCCN2C)C1 |
| InChI | InChI=1S/C11H19N/c1-9-5-6-11-10(8-9)4-3-7-12(11)2/h5,10-11H,3-4,6-8H2,1-2H3 |
| InChIKey | HWUQOWOJRSMENS-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|