C15H24O4S — CID 135226853
methyl 5-ethylsulfanyl-2-methyl-2-(2-methylprop-2-enoyloxy)cyclohexane-1-carboxylate (PubChem CID 135226853) has the molecular formula C15H24O4S and a molecular weight of 300.42 g/mol. Its IUPAC name is methyl 5-ethylsulfanyl-2-methyl-2-(2-methylprop-2-enoyloxy)cyclohexane-1-carboxylate.
| Compound Name | methyl 5-ethylsulfanyl-2-methyl-2-(2-methylprop-2-enoyloxy)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 135226853 |
| Molecular Formula | C15H24O4S |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | methyl 5-ethylsulfanyl-2-methyl-2-(2-methylprop-2-enoyloxy)cyclohexane-1-carboxylate |
| SMILES | C=C(C)C(=O)OC1(C)CCC(SCC)CC1C(=O)OC |
| InChI | InChI=1S/C15H24O4S/c1-6-20-11-7-8-15(4,19-13(16)10(2)3)12(9-11)14(17)18-5/h11-12H,2,6-9H2,1,3-5H3 |
| InChIKey | ZUXWNUYCFNKYKB-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|