C13H15BrF2O — CID 135227009
2-bromo-1-(4,4-difluorocyclohexyl)oxy-4-methylbenzene (PubChem CID 135227009) has the molecular formula C13H15BrF2O and a molecular weight of 305.16 g/mol. Its IUPAC name is 2-bromo-1-(4,4-difluorocyclohexyl)oxy-4-methylbenzene.
| Compound Name | 2-bromo-1-(4,4-difluorocyclohexyl)oxy-4-methylbenzene |
|---|---|
| PubChem CID | 135227009 |
| Molecular Formula | C13H15BrF2O |
| Molecular Weight | 305.16 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | 2-bromo-1-(4,4-difluorocyclohexyl)oxy-4-methylbenzene |
| SMILES | Cc1ccc(OC2CCC(F)(F)CC2)c(Br)c1 |
| InChI | InChI=1S/C13H15BrF2O/c1-9-2-3-12(11(14)8-9)17-10-4-6-13(15,16)7-5-10/h2-3,8,10H,4-7H2,1H3 |
| InChIKey | HKPHSTOESYGFBB-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.16 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |