About (Z)-4-ethenyl-9,9-difluorodec-6-en-3-amine
(Z)-4-ethenyl-9,9-difluorodec-6-en-3-amine (PubChem CID 135227277) has the molecular formula C12H21F2N
and a molecular weight of 217.30 g/mol. Its IUPAC name is (Z)-4-ethenyl-9,9-difluorodec-6-en-3-amine.
Molecular Properties
| Compound Name | (Z)-4-ethenyl-9,9-difluorodec-6-en-3-amine |
| PubChem CID | 135227277 |
| Molecular Formula | C12H21F2N |
| Molecular Weight | 217.30 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | (Z)-4-ethenyl-9,9-difluorodec-6-en-3-amine |
| SMILES | C=CC(C/C=C\CC(C)(F)F)C(N)CC |
| InChI | InChI=1S/C12H21F2N/c1-4-10(11(15)5-2)8-6-7-9-12(3,13)14/h4,6-7,10-11H,1,5,8-9,15H2,2-3H3/b7-6- |
| InChIKey | PLNMLUHLQLYLFD-SREVYHEPSA-N |
| XLogP | 3.52 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.30 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4-ethenyl-9,9-difluorodec-6-en-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-ethenyl-9,9-difluorodec-6-en-3-amine?
The IUPAC name of (Z)-4-ethenyl-9,9-difluorodec-6-en-3-amine (CID 135227277) is (Z)-4-ethenyl-9,9-difluorodec-6-en-3-amine.
What is the SMILES notation for (Z)-4-ethenyl-9,9-difluorodec-6-en-3-amine?
The canonical SMILES for (Z)-4-ethenyl-9,9-difluorodec-6-en-3-amine is C=CC(C/C=C\CC(C)(F)F)C(N)CC.
What is the InChIKey of (Z)-4-ethenyl-9,9-difluorodec-6-en-3-amine?
The InChIKey is PLNMLUHLQLYLFD-SREVYHEPSA-N. The full InChI is InChI=1S/C12H21F2N/c1-4-10(11(15)5-2)8-6-7-9-12(3,13)14/h4,6-7,10-11H,1,5,8-9,15H2,2-3H3/b7-6-.
What are the key properties of (Z)-4-ethenyl-9,9-difluorodec-6-en-3-amine?
(Z)-4-ethenyl-9,9-difluorodec-6-en-3-amine has a molecular weight of 217.30 g/mol, XLogP of 3.52, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-ethenyl-9,9-difluorodec-6-en-3-amine is sourced from PubChem (CID 135227277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).