C21H43N — CID 135227484
N,1,2-trimethyl-N-[(3S)-4-methylnonan-3-yl]cyclooctan-1-amine (PubChem CID 135227484) has the molecular formula C21H43N and a molecular weight of 309.58 g/mol. Its IUPAC name is N,1,2-trimethyl-N-[(3S)-4-methylnonan-3-yl]cyclooctan-1-amine.
| Compound Name | N,1,2-trimethyl-N-[(3S)-4-methylnonan-3-yl]cyclooctan-1-amine |
|---|---|
| PubChem CID | 135227484 |
| Molecular Formula | C21H43N |
| Molecular Weight | 309.58 g/mol |
| Exact Mass | 309.34 |
| IUPAC Name | N,1,2-trimethyl-N-[(3S)-4-methylnonan-3-yl]cyclooctan-1-amine |
| SMILES | CCCCCC(C)[C@H](CC)N(C)C1(C)CCCCCCC1C |
| InChI | InChI=1S/C21H43N/c1-7-9-12-15-18(3)20(8-2)22(6)21(5)17-14-11-10-13-16-19(21)4/h18-20H,7-17H2,1-6H3/t18?,19?,20-,21?/m0/s1 |
| InChIKey | LRINWDHUAUGWEW-WVEVRRLPSA-N |
| XLogP | 6.66 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.58 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|