C18H19N — CID 135227535
N,10-dimethyl-N-phenylcyclodeca-1,3,5,7,9-pentaen-1-amine (PubChem CID 135227535) has the molecular formula C18H19N and a molecular weight of 249.36 g/mol. Its IUPAC name is N,10-dimethyl-N-phenylcyclodeca-1,3,5,7,9-pentaen-1-amine.
| Compound Name | N,10-dimethyl-N-phenylcyclodeca-1,3,5,7,9-pentaen-1-amine |
|---|---|
| PubChem CID | 135227535 |
| Molecular Formula | C18H19N |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | N,10-dimethyl-N-phenylcyclodeca-1,3,5,7,9-pentaen-1-amine |
| SMILES | Cc1ccccccccc1N(C)c1ccccc1 |
| InChI | InChI=1S/C18H19N/c1-16-12-8-5-3-4-6-11-15-18(16)19(2)17-13-9-7-10-14-17/h3-15H,1-2H3/b4-3-,5-3-,6-4-,8-5+,11-6+,12-8+,15-11+,16-12-,18-15+,18-16+ |
| InChIKey | OVHBKTRWQSNMIJ-KJYJPNQJSA-N |
| XLogP | 4.89 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |