About 2-oct-1-en-4-ylaziridine
2-oct-1-en-4-ylaziridine (PubChem CID 135227727) has the molecular formula C10H19N
and a molecular weight of 153.27 g/mol. Its IUPAC name is 2-oct-1-en-4-ylaziridine.
Molecular Properties
| Compound Name | 2-oct-1-en-4-ylaziridine |
| PubChem CID | 135227727 |
| Molecular Formula | C10H19N |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.15 |
| IUPAC Name | 2-oct-1-en-4-ylaziridine |
| SMILES | C=CCC(CCCC)C1CN1 |
| InChI | InChI=1S/C10H19N/c1-3-5-7-9(6-4-2)10-8-11-10/h4,9-11H,2-3,5-8H2,1H3 |
| InChIKey | YVBNEIYQHKEGNE-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 21.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-oct-1-en-4-ylaziridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oct-1-en-4-ylaziridine?
The IUPAC name of 2-oct-1-en-4-ylaziridine (CID 135227727) is 2-oct-1-en-4-ylaziridine.
What is the SMILES notation for 2-oct-1-en-4-ylaziridine?
The canonical SMILES for 2-oct-1-en-4-ylaziridine is C=CCC(CCCC)C1CN1.
What is the InChIKey of 2-oct-1-en-4-ylaziridine?
The InChIKey is YVBNEIYQHKEGNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N/c1-3-5-7-9(6-4-2)10-8-11-10/h4,9-11H,2-3,5-8H2,1H3.
What are the key properties of 2-oct-1-en-4-ylaziridine?
2-oct-1-en-4-ylaziridine has a molecular weight of 153.27 g/mol, XLogP of 2.34, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oct-1-en-4-ylaziridine is sourced from PubChem (CID 135227727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).